C21H24N4O — CID 149197235
N-[1-[4-[(1-cyclohexylbenzimidazol-2-yl)amino]phenyl]ethenyl]hydroxylamine (PubChem CID 149197235) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is N-[1-[4-[(1-cyclohexylbenzimidazol-2-yl)amino]phenyl]ethenyl]hydroxylamine.
| Compound Name | N-[1-[4-[(1-cyclohexylbenzimidazol-2-yl)amino]phenyl]ethenyl]hydroxylamine |
|---|---|
| PubChem CID | 149197235 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-[1-[4-[(1-cyclohexylbenzimidazol-2-yl)amino]phenyl]ethenyl]hydroxylamine |
| SMILES | C=C(NO)c1ccc(Nc2nc3ccccc3n2C2CCCCC2)cc1 |
| InChI | InChI=1S/C21H24N4O/c1-15(24-26)16-11-13-17(14-12-16)22-21-23-19-9-5-6-10-20(19)25(21)18-7-3-2-4-8-18/h5-6,9-14,18,24,26H,1-4,7-8H2,(H,22,23) |
| InChIKey | XDZOKHCQLYVOPM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|