C16H19ClO3 — CID 137448223
2-butan-2-yl-5-(4-chloro-3,5-dimethoxyphenyl)furan (PubChem CID 137448223) has the molecular formula C16H19ClO3 and a molecular weight of 294.78 g/mol. Its IUPAC name is 2-butan-2-yl-5-(4-chloro-3,5-dimethoxyphenyl)furan.
| Compound Name | 2-butan-2-yl-5-(4-chloro-3,5-dimethoxyphenyl)furan |
|---|---|
| PubChem CID | 137448223 |
| Molecular Formula | C16H19ClO3 |
| Molecular Weight | 294.78 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-butan-2-yl-5-(4-chloro-3,5-dimethoxyphenyl)furan |
| SMILES | CCC(C)c1ccc(-c2cc(OC)c(Cl)c(OC)c2)o1 |
| InChI | InChI=1S/C16H19ClO3/c1-5-10(2)12-6-7-13(20-12)11-8-14(18-3)16(17)15(9-11)19-4/h6-10H,5H2,1-4H3 |
| InChIKey | YOGCZCXKCQMTMZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.78 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |