C16H24N2O5 — CID 137450784
tert-butyl N-[1-[(3S)-3-methoxyoxan-4-yl]-2-oxo-3-pyridinyl]carbamate (PubChem CID 137450784) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is tert-butyl N-[1-[(3S)-3-methoxyoxan-4-yl]-2-oxo-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[1-[(3S)-3-methoxyoxan-4-yl]-2-oxo-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 137450784 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | tert-butyl N-[1-[(3S)-3-methoxyoxan-4-yl]-2-oxo-3-pyridinyl]carbamate |
| SMILES | CO[C@@H]1COCCC1n1cccc(NC(=O)OC(C)(C)C)c1=O |
| InChI | InChI=1S/C16H24N2O5/c1-16(2,3)23-15(20)17-11-6-5-8-18(14(11)19)12-7-9-22-10-13(12)21-4/h5-6,8,12-13H,7,9-10H2,1-4H3,(H,17,20)/t12?,13-/m1/s1 |
| InChIKey | MYYXHGMFKNDDCD-ZGTCLIOFSA-N |
| XLogP | 2.17 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |