About tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate
tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate (PubChem CID 137452618) has the molecular formula C12H24O3S
and a molecular weight of 248.39 g/mol. Its IUPAC name is tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate.
Molecular Properties
| Compound Name | tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate |
| PubChem CID | 137452618 |
| Molecular Formula | C12H24O3S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate |
| SMILES | CC(C)(C)OC(=O)C(=O)S(C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24O3S/c1-11(2,3)15-9(13)10(14)16(7,8)12(4,5)6/h1-8H3 |
| InChIKey | XAIQDWZSTDDJPT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate?
The IUPAC name of tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate (CID 137452618) is tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate.
What is the SMILES notation for tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate?
The canonical SMILES for tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate is CC(C)(C)OC(=O)C(=O)S(C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate?
The InChIKey is XAIQDWZSTDDJPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O3S/c1-11(2,3)15-9(13)10(14)16(7,8)12(4,5)6/h1-8H3.
What are the key properties of tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate?
tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate has a molecular weight of 248.39 g/mol, XLogP of 2.72, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[tert-butyl(dimethyl)-λ4-sulfanyl]-2-oxoacetate is sourced from PubChem (CID 137452618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).