C15H28O6S2 — CID 90766669
tert-butyl 2-methylsulfonylprop-2-enoate;2-methyl-2-prop-1-en-2-ylsulfonylpropane (PubChem CID 90766669) has the molecular formula C15H28O6S2 and a molecular weight of 368.52 g/mol. Its IUPAC name is tert-butyl 2-methylsulfonylprop-2-enoate;2-methyl-2-prop-1-en-2-ylsulfonylpropane.
| Compound Name | tert-butyl 2-methylsulfonylprop-2-enoate;2-methyl-2-prop-1-en-2-ylsulfonylpropane |
|---|---|
| PubChem CID | 90766669 |
| Molecular Formula | C15H28O6S2 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | tert-butyl 2-methylsulfonylprop-2-enoate;2-methyl-2-prop-1-en-2-ylsulfonylpropane |
| SMILES | C=C(C(=O)OC(C)(C)C)S(C)(=O)=O.C=C(C)S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C8H14O4S.C7H14O2S/c1-6(13(5,10)11)7(9)12-8(2,3)4;1-6(2)10(8,9)7(3,4)5/h1H2,2-5H3;1H2,2-5H3 |
| InChIKey | CRIUQSFHDBAWLZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|