C16H21F6IO3 — CID 137452840
2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]ethyl 2-iodobutanoate (PubChem CID 137452840) has the molecular formula C16H21F6IO3 and a molecular weight of 502.23 g/mol. Its IUPAC name is 2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]ethyl 2-iodobutanoate.
| Compound Name | 2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]ethyl 2-iodobutanoate |
|---|---|
| PubChem CID | 137452840 |
| Molecular Formula | C16H21F6IO3 |
| Molecular Weight | 502.23 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | 2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-bicyclo[2.2.1]heptanyl]ethyl 2-iodobutanoate |
| SMILES | CCC(I)C(=O)OCCC1CC2CC1CC2C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C16H21F6IO3/c1-2-12(23)13(24)26-4-3-8-5-10-6-9(8)7-11(10)14(25,15(17,18)19)16(20,21)22/h8-12,25H,2-7H2,1H3 |
| InChIKey | VFAXPKJFECJCAS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.23 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|