C11H22N2 — CID 137453469
2-imino-N,N-dipropylpent-4-en-1-amine (PubChem CID 137453469) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-imino-N,N-dipropylpent-4-en-1-amine.
| Compound Name | 2-imino-N,N-dipropylpent-4-en-1-amine |
|---|---|
| PubChem CID | 137453469 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2-imino-N,N-dipropylpent-4-en-1-amine |
| SMILES | [H]/N=C(\CC=C)CN(CCC)CCC |
| InChI | InChI=1S/C11H22N2/c1-4-7-11(12)10-13(8-5-2)9-6-3/h4,12H,1,5-10H2,2-3H3/b12-11+ |
| InChIKey | BOOIYMMLTFIBBL-VAWYXSNFSA-N |
| XLogP | 2.70 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|