C15H30N2 — CID 154938731
N'-(2-methylprop-2-enyl)-N-prop-2-enyl-N,N'-dipropylethane-1,2-diamine (PubChem CID 154938731) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is N'-(2-methylprop-2-enyl)-N-prop-2-enyl-N,N'-dipropylethane-1,2-diamine.
| Compound Name | N'-(2-methylprop-2-enyl)-N-prop-2-enyl-N,N'-dipropylethane-1,2-diamine |
|---|---|
| PubChem CID | 154938731 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | N'-(2-methylprop-2-enyl)-N-prop-2-enyl-N,N'-dipropylethane-1,2-diamine |
| SMILES | C=CCN(CCC)CCN(CCC)CC(=C)C |
| InChI | InChI=1S/C15H30N2/c1-6-9-16(10-7-2)12-13-17(11-8-3)14-15(4)5/h6H,1,4,7-14H2,2-3,5H3 |
| InChIKey | MCLKDKQXCQSSDU-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|