C16H23N3 — CID 137454881
2-[(2S)-2,3-dimethyl-1,3-diazepan-1-yl]-1-methylindole (PubChem CID 137454881) has the molecular formula C16H23N3 and a molecular weight of 257.38 g/mol. Its IUPAC name is 2-[(2S)-2,3-dimethyl-1,3-diazepan-1-yl]-1-methylindole.
| Compound Name | 2-[(2S)-2,3-dimethyl-1,3-diazepan-1-yl]-1-methylindole |
|---|---|
| PubChem CID | 137454881 |
| Molecular Formula | C16H23N3 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.19 |
| IUPAC Name | 2-[(2S)-2,3-dimethyl-1,3-diazepan-1-yl]-1-methylindole |
| SMILES | C[C@H]1N(C)CCCCN1c1cc2ccccc2n1C |
| InChI | InChI=1S/C16H23N3/c1-13-17(2)10-6-7-11-19(13)16-12-14-8-4-5-9-15(14)18(16)3/h4-5,8-9,12-13H,6-7,10-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | UMNSQAPFHMLDAF-ZDUSSCGKSA-N |
| XLogP | 3.06 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |