C7H13NO2S — CID 137455013
(2S,4R)-4-(sulfanylmethyl)piperidine-2-carboxylic acid (PubChem CID 137455013) has the molecular formula C7H13NO2S and a molecular weight of 175.25 g/mol. Its IUPAC name is (2S,4R)-4-(sulfanylmethyl)piperidine-2-carboxylic acid.
| Compound Name | (2S,4R)-4-(sulfanylmethyl)piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 137455013 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | (2S,4R)-4-(sulfanylmethyl)piperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@@H]1C[C@H](CS)CCN1 |
| InChI | InChI=1S/C7H13NO2S/c9-7(10)6-3-5(4-11)1-2-8-6/h5-6,8,11H,1-4H2,(H,9,10)/t5-,6+/m1/s1 |
| InChIKey | WKHMXRFTKGHGOI-RITPCOANSA-N |
| XLogP | 0.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|