C9H16NO5P — CID 14541469
(2R,4S)-4-[(E)-3-phosphonoprop-2-enyl]piperidine-2-carboxylic acid (PubChem CID 14541469) has the molecular formula C9H16NO5P and a molecular weight of 249.20 g/mol. Its IUPAC name is (2R,4S)-4-[(E)-3-phosphonoprop-2-enyl]piperidine-2-carboxylic acid.
| Compound Name | (2R,4S)-4-[(E)-3-phosphonoprop-2-enyl]piperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 14541469 |
| Molecular Formula | C9H16NO5P |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (2R,4S)-4-[(E)-3-phosphonoprop-2-enyl]piperidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1C[C@@H](C/C=C/P(=O)(O)O)CCN1 |
| InChI | InChI=1S/C9H16NO5P/c11-9(12)8-6-7(3-4-10-8)2-1-5-16(13,14)15/h1,5,7-8,10H,2-4,6H2,(H,11,12)(H2,13,14,15)/b5-1+/t7-,8+/m0/s1 |
| InChIKey | KWMQTYXPEOXMJB-QJBKVAQWSA-N |
| XLogP | 0.52 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|