C5H11FNO5P — CID 157183973
fluorophosphonic acid;pyrrolidine-2-carboxylic acid (PubChem CID 157183973) has the molecular formula C5H11FNO5P and a molecular weight of 215.12 g/mol. Its IUPAC name is fluorophosphonic acid;pyrrolidine-2-carboxylic acid.
| Compound Name | fluorophosphonic acid;pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 157183973 |
| Molecular Formula | C5H11FNO5P |
| Molecular Weight | 215.12 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | fluorophosphonic acid;pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)C1CCCN1.O=P(O)(O)F |
| InChI | InChI=1S/C5H9NO2.FH2O3P/c7-5(8)4-2-1-3-6-4;1-5(2,3)4/h4,6H,1-3H2,(H,7,8);(H2,2,3,4) |
| InChIKey | AOWWREVOAOJQNS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.12 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|