C19H17Cl2N7O3 — CID 137455378
8-(cyclopropylamino)-7-[[5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1,3-dimethylpurine-2,6-dione (PubChem CID 137455378) has the molecular formula C19H17Cl2N7O3 and a molecular weight of 462.30 g/mol. Its IUPAC name is 8-(cyclopropylamino)-7-[[5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1,3-dimethylpurine-2,6-dione.
| Compound Name | 8-(cyclopropylamino)-7-[[5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 137455378 |
| Molecular Formula | C19H17Cl2N7O3 |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 8-(cyclopropylamino)-7-[[5-(3,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]methyl]-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(nc(NC3CC3)n2Cc2nnc(-c3ccc(Cl)c(Cl)c3)o2)n(C)c1=O |
| InChI | InChI=1S/C19H17Cl2N7O3/c1-26-15-14(17(29)27(2)19(26)30)28(18(23-15)22-10-4-5-10)8-13-24-25-16(31-13)9-3-6-11(20)12(21)7-9/h3,6-7,10H,4-5,8H2,1-2H3,(H,22,23) |
| InChIKey | LVKCAQNCPUSTKY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 112.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |