C12H15N3O2S — CID 137462545
4-methoxy-7-(oxan-4-yl)-[1,3]thiazolo[4,5-c]pyridin-2-amine (PubChem CID 137462545) has the molecular formula C12H15N3O2S and a molecular weight of 265.34 g/mol. Its IUPAC name is 4-methoxy-7-(oxan-4-yl)-[1,3]thiazolo[4,5-c]pyridin-2-amine.
| Compound Name | 4-methoxy-7-(oxan-4-yl)-[1,3]thiazolo[4,5-c]pyridin-2-amine |
|---|---|
| PubChem CID | 137462545 |
| Molecular Formula | C12H15N3O2S |
| Molecular Weight | 265.34 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 4-methoxy-7-(oxan-4-yl)-[1,3]thiazolo[4,5-c]pyridin-2-amine |
| SMILES | COc1ncc(C2CCOCC2)c2sc(N)nc12 |
| InChI | InChI=1S/C12H15N3O2S/c1-16-11-9-10(18-12(13)15-9)8(6-14-11)7-2-4-17-5-3-7/h6-7H,2-5H2,1H3,(H2,13,15) |
| InChIKey | REKLDYNCSIKJLF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.34 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |