C6H6N4OS — CID 57476597
7-methoxy-[1,3]thiazolo[5,4-d]pyrimidin-2-amine (PubChem CID 57476597) has the molecular formula C6H6N4OS and a molecular weight of 182.21 g/mol. Its IUPAC name is 7-methoxy-[1,3]thiazolo[5,4-d]pyrimidin-2-amine.
| Compound Name | 7-methoxy-[1,3]thiazolo[5,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 57476597 |
| Molecular Formula | C6H6N4OS |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 7-methoxy-[1,3]thiazolo[5,4-d]pyrimidin-2-amine |
| SMILES | COc1ncnc2sc(N)nc12 |
| InChI | InChI=1S/C6H6N4OS/c1-11-4-3-5(9-2-8-4)12-6(7)10-3/h2H,1H3,(H2,7,10) |
| InChIKey | QPKYPGWRTFUFOU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |