C17H17NO2 — CID 137465399
(E)-N-naphthalen-2-yl-3-(oxolan-2-yl)prop-2-enamide (PubChem CID 137465399) has the molecular formula C17H17NO2 and a molecular weight of 267.33 g/mol. Its IUPAC name is (E)-N-naphthalen-2-yl-3-(oxolan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-naphthalen-2-yl-3-(oxolan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 137465399 |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | (E)-N-naphthalen-2-yl-3-(oxolan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/C1CCCO1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H17NO2/c19-17(10-9-16-6-3-11-20-16)18-15-8-7-13-4-1-2-5-14(13)12-15/h1-2,4-5,7-10,12,16H,3,6,11H2,(H,18,19)/b10-9+ |
| InChIKey | MWNRZFZRNNABFQ-MDZDMXLPSA-N |
| XLogP | 3.51 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|