C20H20N2O3 — CID 137465400
(E)-N-[3-(2,3-dihydro-1,3-benzoxazol-2-yl)phenyl]-3-(oxolan-2-yl)prop-2-enamide (PubChem CID 137465400) has the molecular formula C20H20N2O3 and a molecular weight of 336.39 g/mol. Its IUPAC name is (E)-N-[3-(2,3-dihydro-1,3-benzoxazol-2-yl)phenyl]-3-(oxolan-2-yl)prop-2-enamide.
| Compound Name | (E)-N-[3-(2,3-dihydro-1,3-benzoxazol-2-yl)phenyl]-3-(oxolan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 137465400 |
| Molecular Formula | C20H20N2O3 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (E)-N-[3-(2,3-dihydro-1,3-benzoxazol-2-yl)phenyl]-3-(oxolan-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/C1CCCO1)Nc1cccc(C2Nc3ccccc3O2)c1 |
| InChI | InChI=1S/C20H20N2O3/c23-19(11-10-16-7-4-12-24-16)21-15-6-3-5-14(13-15)20-22-17-8-1-2-9-18(17)25-20/h1-3,5-6,8-11,13,16,20,22H,4,7,12H2,(H,21,23)/b11-10+ |
| InChIKey | UGDWBWIYOSZJES-ZHACJKMWSA-N |
| XLogP | 3.86 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|