C28H28ClIN2O3S2 — CID 137465568
[(2S,7S,8aS)-1-(4-chlorophenyl)sulfonyl-4-ethoxy-2,7-diphenyl-2,3,5,7,8,8a-hexahydro-1,6-naphthyridin-6-yl] thiohypoiodite (PubChem CID 137465568) has the molecular formula C28H28ClIN2O3S2 and a molecular weight of 667.03 g/mol. Its IUPAC name is [(2S,7S,8aS)-1-(4-chlorophenyl)sulfonyl-4-ethoxy-2,7-diphenyl-2,3,5,7,8,8a-hexahydro-1,6-naphthyridin-6-yl] thiohypoiodite.
| Compound Name | [(2S,7S,8aS)-1-(4-chlorophenyl)sulfonyl-4-ethoxy-2,7-diphenyl-2,3,5,7,8,8a-hexahydro-1,6-naphthyridin-6-yl] thiohypoiodite |
|---|---|
| PubChem CID | 137465568 |
| Molecular Formula | C28H28ClIN2O3S2 |
| Molecular Weight | 667.03 g/mol |
| Exact Mass | 666.03 |
| IUPAC Name | [(2S,7S,8aS)-1-(4-chlorophenyl)sulfonyl-4-ethoxy-2,7-diphenyl-2,3,5,7,8,8a-hexahydro-1,6-naphthyridin-6-yl] thiohypoiodite |
| SMILES | CCOC1=C2CN(SI)[C@H](c3ccccc3)C[C@@H]2N(S(=O)(=O)c2ccc(Cl)cc2)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C28H28ClIN2O3S2/c1-2-35-28-18-26(21-11-7-4-8-12-21)32(37(33,34)23-15-13-22(29)14-16-23)27-17-25(20-9-5-3-6-10-20)31(36-30)19-24(27)28/h3-16,25-27H,2,17-19H2,1H3/t25-,26-,27-/m0/s1 |
| InChIKey | YONIAJLFEWUTOI-QKDODKLFSA-N |
| XLogP | 7.58 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.03 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|