C6H12N2 — CID 137466749
2,5-dimethyl-2,5-dihydropyrrol-1-amine (PubChem CID 137466749) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 2,5-dimethyl-2,5-dihydropyrrol-1-amine.
| Compound Name | 2,5-dimethyl-2,5-dihydropyrrol-1-amine |
|---|---|
| PubChem CID | 137466749 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 2,5-dimethyl-2,5-dihydropyrrol-1-amine |
| SMILES | CC1C=CC(C)N1N |
| InChI | InChI=1S/C6H12N2/c1-5-3-4-6(2)8(5)7/h3-6H,7H2,1-2H3 |
| InChIKey | AZEAVBBDDXRQGZ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|