C7H16N2 — CID 142392343
ethane;2-methyl-2,5-dihydropyrrol-1-amine (PubChem CID 142392343) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is ethane;2-methyl-2,5-dihydropyrrol-1-amine.
| Compound Name | ethane;2-methyl-2,5-dihydropyrrol-1-amine |
|---|---|
| PubChem CID | 142392343 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | ethane;2-methyl-2,5-dihydropyrrol-1-amine |
| SMILES | CC.CC1C=CCN1N |
| InChI | InChI=1S/C5H10N2.C2H6/c1-5-3-2-4-7(5)6;1-2/h2-3,5H,4,6H2,1H3;1-2H3 |
| InChIKey | BEYYBLNUAQEMDU-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|