C21H21ClO8 — CID 137467487
(2S)-7-chloro-1'-hydroxy-4-[2-(oxan-2-yloxy)ethoxy]-3,3'-dioxospiro[1-benzofuran-2,6'-cyclohexene]-6-carbaldehyde (PubChem CID 137467487) has the molecular formula C21H21ClO8 and a molecular weight of 436.84 g/mol. Its IUPAC name is (2S)-7-chloro-1'-hydroxy-4-[2-(oxan-2-yloxy)ethoxy]-3,3'-dioxospiro[1-benzofuran-2,6'-cyclohexene]-6-carbaldehyde.
| Compound Name | (2S)-7-chloro-1'-hydroxy-4-[2-(oxan-2-yloxy)ethoxy]-3,3'-dioxospiro[1-benzofuran-2,6'-cyclohexene]-6-carbaldehyde |
|---|---|
| PubChem CID | 137467487 |
| Molecular Formula | C21H21ClO8 |
| Molecular Weight | 436.84 g/mol |
| Exact Mass | 436.09 |
| IUPAC Name | (2S)-7-chloro-1'-hydroxy-4-[2-(oxan-2-yloxy)ethoxy]-3,3'-dioxospiro[1-benzofuran-2,6'-cyclohexene]-6-carbaldehyde |
| SMILES | O=Cc1cc(OCCOC2CCCCO2)c2c(c1Cl)O[C@]1(CCC(=O)C=C1O)C2=O |
| InChI | InChI=1S/C21H21ClO8/c22-18-12(11-23)9-14(27-7-8-29-16-3-1-2-6-28-16)17-19(18)30-21(20(17)26)5-4-13(24)10-15(21)25/h9-11,16,25H,1-8H2/t16?,21-/m0/s1 |
| InChIKey | YXGQVKHETZOLMS-MRNPHLECSA-N |
| XLogP | 3.19 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.84 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|