C27H35ClN2O9 — CID 174137346
[(Z)-1-aminoethylideneamino] 2-chloro-3-hydroxy-4-[(1R,4E,8R)-4-methoxy-8-methyl-6-oxocyclooct-4-ene-1-carbonyl]-5-[2-(oxan-2-yloxy)ethoxy]benzoate (PubChem CID 174137346) has the molecular formula C27H35ClN2O9 and a molecular weight of 567.04 g/mol. Its IUPAC name is [(Z)-1-aminoethylideneamino] 2-chloro-3-hydroxy-4-[(1R,4E,8R)-4-methoxy-8-methyl-6-oxocyclooct-4-ene-1-carbonyl]-5-[2-(oxan-2-yloxy)ethoxy]benzoate.
| Compound Name | [(Z)-1-aminoethylideneamino] 2-chloro-3-hydroxy-4-[(1R,4E,8R)-4-methoxy-8-methyl-6-oxocyclooct-4-ene-1-carbonyl]-5-[2-(oxan-2-yloxy)ethoxy]benzoate |
|---|---|
| PubChem CID | 174137346 |
| Molecular Formula | C27H35ClN2O9 |
| Molecular Weight | 567.04 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | [(Z)-1-aminoethylideneamino] 2-chloro-3-hydroxy-4-[(1R,4E,8R)-4-methoxy-8-methyl-6-oxocyclooct-4-ene-1-carbonyl]-5-[2-(oxan-2-yloxy)ethoxy]benzoate |
| SMILES | CO/C1=C/C(=O)C[C@@H](C)[C@H](C(=O)c2c(OCCOC3CCCCO3)cc(C(=O)O/N=C(/C)N)c(Cl)c2O)CC1 |
| InChI | InChI=1S/C27H35ClN2O9/c1-15-12-17(31)13-18(35-3)7-8-19(15)25(32)23-21(36-10-11-38-22-6-4-5-9-37-22)14-20(24(28)26(23)33)27(34)39-30-16(2)29/h13-15,19,22,33H,4-12H2,1-3H3,(H2,29,30)/b18-13+/t15-,19-,22?/m1/s1 |
| InChIKey | WEJYIIAMYQOGDS-CEXHYWPKSA-N |
| XLogP | 4.13 |
| TPSA | 155.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.04 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|