C21H24ClNO7 — CID 67553942
3-amino-4-(2-chloro-5-methoxyphenoxy)-5-[2-(oxan-2-yloxy)ethoxy]benzoic acid (PubChem CID 67553942) has the molecular formula C21H24ClNO7 and a molecular weight of 437.88 g/mol. Its IUPAC name is 3-amino-4-(2-chloro-5-methoxyphenoxy)-5-[2-(oxan-2-yloxy)ethoxy]benzoic acid.
| Compound Name | 3-amino-4-(2-chloro-5-methoxyphenoxy)-5-[2-(oxan-2-yloxy)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 67553942 |
| Molecular Formula | C21H24ClNO7 |
| Molecular Weight | 437.88 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | 3-amino-4-(2-chloro-5-methoxyphenoxy)-5-[2-(oxan-2-yloxy)ethoxy]benzoic acid |
| SMILES | COc1ccc(Cl)c(Oc2c(N)cc(C(=O)O)cc2OCCOC2CCCCO2)c1 |
| InChI | InChI=1S/C21H24ClNO7/c1-26-14-5-6-15(22)17(12-14)30-20-16(23)10-13(21(24)25)11-18(20)27-8-9-29-19-4-2-3-7-28-19/h5-6,10-12,19H,2-4,7-9,23H2,1H3,(H,24,25) |
| InChIKey | YXSLMWVGYQHXFT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 109.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.88 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|