C15H31NO — CID 137469559
4-ethyl-2,4-dimethyl-6-(3-methylbutylimino)hexan-2-ol (PubChem CID 137469559) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is 4-ethyl-2,4-dimethyl-6-(3-methylbutylimino)hexan-2-ol.
| Compound Name | 4-ethyl-2,4-dimethyl-6-(3-methylbutylimino)hexan-2-ol |
|---|---|
| PubChem CID | 137469559 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 4-ethyl-2,4-dimethyl-6-(3-methylbutylimino)hexan-2-ol |
| SMILES | CCC(C)(C/C=N/CCC(C)C)CC(C)(C)O |
| InChI | InChI=1S/C15H31NO/c1-7-15(6,12-14(4,5)17)9-11-16-10-8-13(2)3/h11,13,17H,7-10,12H2,1-6H3/b16-11+ |
| InChIKey | HXLWVUPXVXGVPB-LFIBNONCSA-N |
| XLogP | 4.07 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|