About 4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol
4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol (PubChem CID 146437345) has the molecular formula C16H36N4O
and a molecular weight of 300.49 g/mol. Its IUPAC name is 4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol.
Molecular Properties
| Compound Name | 4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol |
| PubChem CID | 146437345 |
| Molecular Formula | C16H36N4O |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.29 |
| IUPAC Name | 4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol |
| SMILES | CC(C)CC(C)(C)N(C)/N=N/N(C)C(C)(C)CC(C)(C)O |
| InChI | InChI=1S/C16H36N4O/c1-13(2)11-14(3,4)19(9)17-18-20(10)15(5,6)12-16(7,8)21/h13,21H,11-12H2,1-10H3/b18-17+ |
| InChIKey | BJARFCYMYMQVNU-ISLYRVAYSA-N |
| XLogP | 3.90 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol?
The IUPAC name of 4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol (CID 146437345) is 4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol.
What is the SMILES notation for 4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol?
The canonical SMILES for 4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol is CC(C)CC(C)(C)N(C)/N=N/N(C)C(C)(C)CC(C)(C)O.
What is the InChIKey of 4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol?
The InChIKey is BJARFCYMYMQVNU-ISLYRVAYSA-N. The full InChI is InChI=1S/C16H36N4O/c1-13(2)11-14(3,4)19(9)17-18-20(10)15(5,6)12-16(7,8)21/h13,21H,11-12H2,1-10H3/b18-17+.
What are the key properties of 4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol?
4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol has a molecular weight of 300.49 g/mol, XLogP of 3.90, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(E)-[2,4-dimethylpentan-2-yl(methyl)amino]diazenyl]-methylamino]-2,4-dimethylpentan-2-ol is sourced from PubChem (CID 146437345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).