C15H31N — CID 130314453
N-(2,4-dimethylpent-3-en-2-yl)-N,2,4-trimethylpentan-2-amine (PubChem CID 130314453) has the molecular formula C15H31N and a molecular weight of 225.42 g/mol. Its IUPAC name is N-(2,4-dimethylpent-3-en-2-yl)-N,2,4-trimethylpentan-2-amine.
| Compound Name | N-(2,4-dimethylpent-3-en-2-yl)-N,2,4-trimethylpentan-2-amine |
|---|---|
| PubChem CID | 130314453 |
| Molecular Formula | C15H31N |
| Molecular Weight | 225.42 g/mol |
| Exact Mass | 225.25 |
| IUPAC Name | N-(2,4-dimethylpent-3-en-2-yl)-N,2,4-trimethylpentan-2-amine |
| SMILES | CC(C)=CC(C)(C)N(C)C(C)(C)CC(C)C |
| InChI | InChI=1S/C15H31N/c1-12(2)10-14(5,6)16(9)15(7,8)11-13(3)4/h10,13H,11H2,1-9H3 |
| InChIKey | YHIZWMGYJHMWMT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|