C16H33N — CID 174381732
(Z)-N,2,4,5,7-pentamethyl-N-propyloct-5-en-4-amine (PubChem CID 174381732) has the molecular formula C16H33N and a molecular weight of 239.45 g/mol. Its IUPAC name is (Z)-N,2,4,5,7-pentamethyl-N-propyloct-5-en-4-amine.
| Compound Name | (Z)-N,2,4,5,7-pentamethyl-N-propyloct-5-en-4-amine |
|---|---|
| PubChem CID | 174381732 |
| Molecular Formula | C16H33N |
| Molecular Weight | 239.45 g/mol |
| Exact Mass | 239.26 |
| IUPAC Name | (Z)-N,2,4,5,7-pentamethyl-N-propyloct-5-en-4-amine |
| SMILES | CCCN(C)C(C)(CC(C)C)/C(C)=C\C(C)C |
| InChI | InChI=1S/C16H33N/c1-9-10-17(8)16(7,12-14(4)5)15(6)11-13(2)3/h11,13-14H,9-10,12H2,1-8H3/b15-11- |
| InChIKey | IHNWOWBFGYSRIO-PTNGSMBKSA-N |
| XLogP | 4.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.45 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|