C15H32OS — CID 145142584
2,4-dimethyl-4-(2,2,4-trimethylpentoxy)pentane-2-thiol (PubChem CID 145142584) has the molecular formula C15H32OS and a molecular weight of 260.49 g/mol. Its IUPAC name is 2,4-dimethyl-4-(2,2,4-trimethylpentoxy)pentane-2-thiol.
| Compound Name | 2,4-dimethyl-4-(2,2,4-trimethylpentoxy)pentane-2-thiol |
|---|---|
| PubChem CID | 145142584 |
| Molecular Formula | C15H32OS |
| Molecular Weight | 260.49 g/mol |
| Exact Mass | 260.22 |
| IUPAC Name | 2,4-dimethyl-4-(2,2,4-trimethylpentoxy)pentane-2-thiol |
| SMILES | CC(C)CC(C)(C)COC(C)(C)CC(C)(C)S |
| InChI | InChI=1S/C15H32OS/c1-12(2)9-13(3,4)11-16-14(5,6)10-15(7,8)17/h12,17H,9-11H2,1-8H3 |
| InChIKey | QTQMLSLPRQDSOJ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|