C15H32OS — CID 156522374
4-(2,4,4,6-tetramethylheptan-2-yloxy)butane-2-thiol (PubChem CID 156522374) has the molecular formula C15H32OS and a molecular weight of 260.49 g/mol. Its IUPAC name is 4-(2,4,4,6-tetramethylheptan-2-yloxy)butane-2-thiol.
| Compound Name | 4-(2,4,4,6-tetramethylheptan-2-yloxy)butane-2-thiol |
|---|---|
| PubChem CID | 156522374 |
| Molecular Formula | C15H32OS |
| Molecular Weight | 260.49 g/mol |
| Exact Mass | 260.22 |
| IUPAC Name | 4-(2,4,4,6-tetramethylheptan-2-yloxy)butane-2-thiol |
| SMILES | CC(C)CC(C)(C)CC(C)(C)OCCC(C)S |
| InChI | InChI=1S/C15H32OS/c1-12(2)10-14(4,5)11-15(6,7)16-9-8-13(3)17/h12-13,17H,8-11H2,1-7H3 |
| InChIKey | VJUCHYUSCYICLA-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|