C14H29ClO — CID 175624784
7-chloro-2,4,4-trimethyl-2-propoxyoctane (PubChem CID 175624784) has the molecular formula C14H29ClO and a molecular weight of 248.84 g/mol. Its IUPAC name is 7-chloro-2,4,4-trimethyl-2-propoxyoctane.
| Compound Name | 7-chloro-2,4,4-trimethyl-2-propoxyoctane |
|---|---|
| PubChem CID | 175624784 |
| Molecular Formula | C14H29ClO |
| Molecular Weight | 248.84 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | 7-chloro-2,4,4-trimethyl-2-propoxyoctane |
| SMILES | CCCOC(C)(C)CC(C)(C)CCC(C)Cl |
| InChI | InChI=1S/C14H29ClO/c1-7-10-16-14(5,6)11-13(3,4)9-8-12(2)15/h12H,7-11H2,1-6H3 |
| InChIKey | PNTXXFVHTOGXIN-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.84 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|