C15H31ClO — CID 175625445
5-chloro-1-(2,3-dimethylpentan-2-yloxy)-2,2-dimethylhexane (PubChem CID 175625445) has the molecular formula C15H31ClO and a molecular weight of 262.86 g/mol. Its IUPAC name is 5-chloro-1-(2,3-dimethylpentan-2-yloxy)-2,2-dimethylhexane.
| Compound Name | 5-chloro-1-(2,3-dimethylpentan-2-yloxy)-2,2-dimethylhexane |
|---|---|
| PubChem CID | 175625445 |
| Molecular Formula | C15H31ClO |
| Molecular Weight | 262.86 g/mol |
| Exact Mass | 262.21 |
| IUPAC Name | 5-chloro-1-(2,3-dimethylpentan-2-yloxy)-2,2-dimethylhexane |
| SMILES | CCC(C)C(C)(C)OCC(C)(C)CCC(C)Cl |
| InChI | InChI=1S/C15H31ClO/c1-8-12(2)15(6,7)17-11-14(4,5)10-9-13(3)16/h12-13H,8-11H2,1-7H3 |
| InChIKey | FUYYEBMSGDYSSN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.86 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|