C15H32O2S — CID 88986891
6-(3-methoxy-3-methylpentoxy)-6-methylheptane-2-thiol (PubChem CID 88986891) has the molecular formula C15H32O2S and a molecular weight of 276.49 g/mol. Its IUPAC name is 6-(3-methoxy-3-methylpentoxy)-6-methylheptane-2-thiol.
| Compound Name | 6-(3-methoxy-3-methylpentoxy)-6-methylheptane-2-thiol |
|---|---|
| PubChem CID | 88986891 |
| Molecular Formula | C15H32O2S |
| Molecular Weight | 276.49 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 6-(3-methoxy-3-methylpentoxy)-6-methylheptane-2-thiol |
| SMILES | CCC(C)(CCOC(C)(C)CCCC(C)S)OC |
| InChI | InChI=1S/C15H32O2S/c1-7-15(5,16-6)11-12-17-14(3,4)10-8-9-13(2)18/h13,18H,7-12H2,1-6H3 |
| InChIKey | JPSSYHNKYJEVQK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|