C20H25N3O2 — CID 137470952
ethyl 3-amino-2-[(6-phenyl-2-pyridinyl)methyl]piperidine-1-carboxylate (PubChem CID 137470952) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is ethyl 3-amino-2-[(6-phenyl-2-pyridinyl)methyl]piperidine-1-carboxylate.
| Compound Name | ethyl 3-amino-2-[(6-phenyl-2-pyridinyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137470952 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | ethyl 3-amino-2-[(6-phenyl-2-pyridinyl)methyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCCC(N)C1Cc1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H25N3O2/c1-2-25-20(24)23-13-7-11-17(21)19(23)14-16-10-6-12-18(22-16)15-8-4-3-5-9-15/h3-6,8-10,12,17,19H,2,7,11,13-14,21H2,1H3 |
| InChIKey | XFJMDPWVJNFWFE-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |