C18H21N3O2 — CID 154960189
3-amino-2-[(6-phenyl-2-pyridinyl)methyl]piperidine-1-carboxylic acid (PubChem CID 154960189) has the molecular formula C18H21N3O2 and a molecular weight of 311.38 g/mol. Its IUPAC name is 3-amino-2-[(6-phenyl-2-pyridinyl)methyl]piperidine-1-carboxylic acid.
| Compound Name | 3-amino-2-[(6-phenyl-2-pyridinyl)methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154960189 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 3-amino-2-[(6-phenyl-2-pyridinyl)methyl]piperidine-1-carboxylic acid |
| SMILES | NC1CCCN(C(=O)O)C1Cc1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H21N3O2/c19-15-9-5-11-21(18(22)23)17(15)12-14-8-4-10-16(20-14)13-6-2-1-3-7-13/h1-4,6-8,10,15,17H,5,9,11-12,19H2,(H,22,23) |
| InChIKey | LDSQEMIEXYWEMN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |