C25H27N3O2 — CID 174109707
benzyl-[(2S,3S)-2-[(6-phenyl-2-pyridinyl)methyl]piperidin-3-yl]carbamic acid (PubChem CID 174109707) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is benzyl-[(2S,3S)-2-[(6-phenyl-2-pyridinyl)methyl]piperidin-3-yl]carbamic acid.
| Compound Name | benzyl-[(2S,3S)-2-[(6-phenyl-2-pyridinyl)methyl]piperidin-3-yl]carbamic acid |
|---|---|
| PubChem CID | 174109707 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | benzyl-[(2S,3S)-2-[(6-phenyl-2-pyridinyl)methyl]piperidin-3-yl]carbamic acid |
| SMILES | O=C(O)N(Cc1ccccc1)[C@H]1CCCN[C@H]1Cc1cccc(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H27N3O2/c29-25(30)28(18-19-9-3-1-4-10-19)24-15-8-16-26-23(24)17-21-13-7-14-22(27-21)20-11-5-2-6-12-20/h1-7,9-14,23-24,26H,8,15-18H2,(H,29,30)/t23-,24-/m0/s1 |
| InChIKey | PSZVLFOCCLHPGV-ZEQRLZLVSA-N |
| XLogP | 4.59 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |