C24H30N2O2 — CID 137470985
cyclobutylmethyl 3-amino-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate (PubChem CID 137470985) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is cyclobutylmethyl 3-amino-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate.
| Compound Name | cyclobutylmethyl 3-amino-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 137470985 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | cyclobutylmethyl 3-amino-2-[(3-phenylphenyl)methyl]piperidine-1-carboxylate |
| SMILES | NC1CCCN(C(=O)OCC2CCC2)C1Cc1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C24H30N2O2/c25-22-13-6-14-26(24(27)28-17-18-7-4-8-18)23(22)16-19-9-5-12-21(15-19)20-10-2-1-3-11-20/h1-3,5,9-12,15,18,22-23H,4,6-8,13-14,16-17,25H2 |
| InChIKey | NRDOVHGXZXWUBA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |