C10H10F13NO — CID 137474505
N,N,1,2-tetrafluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butan-1-amine (PubChem CID 137474505) has the molecular formula C10H10F13NO and a molecular weight of 407.17 g/mol. Its IUPAC name is N,N,1,2-tetrafluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butan-1-amine.
| Compound Name | N,N,1,2-tetrafluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butan-1-amine |
|---|---|
| PubChem CID | 137474505 |
| Molecular Formula | C10H10F13NO |
| Molecular Weight | 407.17 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | N,N,1,2-tetrafluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-2-(trifluoromethyl)butan-1-amine |
| SMILES | CC(OC(C)C(F)(C(F)N(F)F)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C10H10F13NO/c1-3(7(13,10(19,20)21)6(12)24(22)23)25-4(2)8(14,15)5(11)9(16,17)18/h3-6H,1-2H3 |
| InChIKey | UGZQXBODJIEKSC-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.17 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|