C12H10F17NO — CID 137474504
1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N,N,2-tris(trifluoromethyl)butan-1-amine (PubChem CID 137474504) has the molecular formula C12H10F17NO and a molecular weight of 507.18 g/mol. Its IUPAC name is 1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N,N,2-tris(trifluoromethyl)butan-1-amine.
| Compound Name | 1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N,N,2-tris(trifluoromethyl)butan-1-amine |
|---|---|
| PubChem CID | 137474504 |
| Molecular Formula | C12H10F17NO |
| Molecular Weight | 507.18 g/mol |
| Exact Mass | 507.05 |
| IUPAC Name | 1,2-difluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N,N,2-tris(trifluoromethyl)butan-1-amine |
| SMILES | CC(OC(C)C(F)(C(F)N(C(F)(F)F)C(F)(F)F)C(F)(F)F)C(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C12H10F17NO/c1-3(31-4(2)8(16,17)5(13)9(18,19)20)7(15,10(21,22)23)6(14)30(11(24,25)26)12(27,28)29/h3-6H,1-2H3 |
| InChIKey | JEHLWVWJWONVQM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.18 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|