C11H10F15NO — CID 130418395
1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N,N-bis(trifluoromethyl)butan-1-amine (PubChem CID 130418395) has the molecular formula C11H10F15NO and a molecular weight of 457.18 g/mol. Its IUPAC name is 1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N,N-bis(trifluoromethyl)butan-1-amine.
| Compound Name | 1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N,N-bis(trifluoromethyl)butan-1-amine |
|---|---|
| PubChem CID | 130418395 |
| Molecular Formula | C11H10F15NO |
| Molecular Weight | 457.18 g/mol |
| Exact Mass | 457.05 |
| IUPAC Name | 1,2,2-trifluoro-3-(3,3,4,5,5,5-hexafluoropentan-2-yloxy)-N,N-bis(trifluoromethyl)butan-1-amine |
| SMILES | CC(OC(C)C(F)(F)C(F)C(F)(F)F)C(F)(F)C(F)N(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H10F15NO/c1-3(7(14,15)5(12)9(18,19)20)28-4(2)8(16,17)6(13)27(10(21,22)23)11(24,25)26/h3-6H,1-2H3 |
| InChIKey | VZDKCIYKJJPYMF-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.18 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|