C15H22F11NO — CID 145366180
N-ethyl-N-[1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]pentan-1-amine (PubChem CID 145366180) has the molecular formula C15H22F11NO and a molecular weight of 441.33 g/mol. Its IUPAC name is N-ethyl-N-[1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]pentan-1-amine.
| Compound Name | N-ethyl-N-[1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]pentan-1-amine |
|---|---|
| PubChem CID | 145366180 |
| Molecular Formula | C15H22F11NO |
| Molecular Weight | 441.33 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N-ethyl-N-[1,2,3,3,3-pentafluoro-2-(2,2,3,4,4,4-hexafluorobutoxymethyl)propyl]pentan-1-amine |
| SMILES | CCCCCN(CC)C(F)C(F)(COCC(F)(F)C(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H22F11NO/c1-3-5-6-7-27(4-2)11(17)12(18,15(24,25)26)8-28-9-13(19,20)10(16)14(21,22)23/h10-11H,3-9H2,1-2H3 |
| InChIKey | WQXIEGBOJRLNIE-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.33 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|