C11H14F9NO — CID 90154484
1-[1,1,2,2,3,3-hexafluoro-3-(1,2,2-trifluoropropoxy)propyl]piperidine (PubChem CID 90154484) has the molecular formula C11H14F9NO and a molecular weight of 347.22 g/mol. Its IUPAC name is 1-[1,1,2,2,3,3-hexafluoro-3-(1,2,2-trifluoropropoxy)propyl]piperidine.
| Compound Name | 1-[1,1,2,2,3,3-hexafluoro-3-(1,2,2-trifluoropropoxy)propyl]piperidine |
|---|---|
| PubChem CID | 90154484 |
| Molecular Formula | C11H14F9NO |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-[1,1,2,2,3,3-hexafluoro-3-(1,2,2-trifluoropropoxy)propyl]piperidine |
| SMILES | CC(F)(F)C(F)OC(F)(F)C(F)(F)C(F)(F)N1CCCCC1 |
| InChI | InChI=1S/C11H14F9NO/c1-8(13,14)7(12)22-11(19,20)9(15,16)10(17,18)21-5-3-2-4-6-21/h7H,2-6H2,1H3 |
| InChIKey | AVVWBDYCYZOFOF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|