C26H39NO2 — CID 137476580
1-[2-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]propyl-(2-methylpropyl)amino]propan-2-ol (PubChem CID 137476580) has the molecular formula C26H39NO2 and a molecular weight of 397.60 g/mol. Its IUPAC name is 1-[2-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]propyl-(2-methylpropyl)amino]propan-2-ol.
| Compound Name | 1-[2-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]propyl-(2-methylpropyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 137476580 |
| Molecular Formula | C26H39NO2 |
| Molecular Weight | 397.60 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | 1-[2-[4-[2-(4-methylphenyl)propan-2-yl]phenoxy]propyl-(2-methylpropyl)amino]propan-2-ol |
| SMILES | Cc1ccc(C(C)(C)c2ccc(OC(C)CN(CC(C)C)CC(C)O)cc2)cc1 |
| InChI | InChI=1S/C26H39NO2/c1-19(2)16-27(17-21(4)28)18-22(5)29-25-14-12-24(13-15-25)26(6,7)23-10-8-20(3)9-11-23/h8-15,19,21-22,28H,16-18H2,1-7H3 |
| InChIKey | UNZJZLVLDRQNGC-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |