C42H72N2O15 — CID 137477404
cyclohexyl 2-[2-[bis[2-(2-cyclohexyloxy-2-oxoethoxy)ethyl]amino]ethoxy]acetate;methyl 3-[bis(3-methoxy-3-oxopropyl)amino]propanoate (PubChem CID 137477404) has the molecular formula C42H72N2O15 and a molecular weight of 845.04 g/mol. Its IUPAC name is cyclohexyl 2-[2-[bis[2-(2-cyclohexyloxy-2-oxoethoxy)ethyl]amino]ethoxy]acetate;methyl 3-[bis(3-methoxy-3-oxopropyl)amino]propanoate.
| Compound Name | cyclohexyl 2-[2-[bis[2-(2-cyclohexyloxy-2-oxoethoxy)ethyl]amino]ethoxy]acetate;methyl 3-[bis(3-methoxy-3-oxopropyl)amino]propanoate |
|---|---|
| PubChem CID | 137477404 |
| Molecular Formula | C42H72N2O15 |
| Molecular Weight | 845.04 g/mol |
| Exact Mass | 844.49 |
| IUPAC Name | cyclohexyl 2-[2-[bis[2-(2-cyclohexyloxy-2-oxoethoxy)ethyl]amino]ethoxy]acetate;methyl 3-[bis(3-methoxy-3-oxopropyl)amino]propanoate |
| SMILES | COC(=O)CCN(CCC(=O)OC)CCC(=O)OC.O=C(COCCN(CCOCC(=O)OC1CCCCC1)CCOCC(=O)OC1CCCCC1)OC1CCCCC1 |
| InChI | InChI=1S/C30H51NO9.C12H21NO6/c32-28(38-25-10-4-1-5-11-25)22-35-19-16-31(17-20-36-23-29(33)39-26-12-6-2-7-13-26)18-21-37-24-30(34)40-27-14-8-3-9-15-27;1-17-10(14)4-7-13(8-5-11(15)18-2)9-6-12(16)19-3/h25-27H,1-24H2;4-9H2,1-3H3 |
| InChIKey | NQPGWBUHXGTBCF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 191.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.04 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|