About cycloheptyl 2-(2-aminoethoxy)acetate
cycloheptyl 2-(2-aminoethoxy)acetate (PubChem CID 79464005) has the molecular formula C11H21NO3
and a molecular weight of 215.29 g/mol. Its IUPAC name is cycloheptyl 2-(2-aminoethoxy)acetate.
Molecular Properties
| Compound Name | cycloheptyl 2-(2-aminoethoxy)acetate |
| PubChem CID | 79464005 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | cycloheptyl 2-(2-aminoethoxy)acetate |
| SMILES | NCCOCC(=O)OC1CCCCCC1 |
| InChI | InChI=1S/C11H21NO3/c12-7-8-14-9-11(13)15-10-5-3-1-2-4-6-10/h10H,1-9,12H2 |
| InChIKey | AOBJEQRSYMWADR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cycloheptyl 2-(2-aminoethoxy)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cycloheptyl 2-(2-aminoethoxy)acetate?
The IUPAC name of cycloheptyl 2-(2-aminoethoxy)acetate (CID 79464005) is cycloheptyl 2-(2-aminoethoxy)acetate.
What is the SMILES notation for cycloheptyl 2-(2-aminoethoxy)acetate?
The canonical SMILES for cycloheptyl 2-(2-aminoethoxy)acetate is NCCOCC(=O)OC1CCCCCC1.
What is the InChIKey of cycloheptyl 2-(2-aminoethoxy)acetate?
The InChIKey is AOBJEQRSYMWADR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3/c12-7-8-14-9-11(13)15-10-5-3-1-2-4-6-10/h10H,1-9,12H2.
What are the key properties of cycloheptyl 2-(2-aminoethoxy)acetate?
cycloheptyl 2-(2-aminoethoxy)acetate has a molecular weight of 215.29 g/mol, XLogP of 1.23, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cycloheptyl 2-(2-aminoethoxy)acetate is sourced from PubChem (CID 79464005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).