C27H32N4O4 — CID 137478985
[7-methoxy-9-(pyridin-3-ylmethylamino)-6-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[b]quinolin-1-yl] formate (PubChem CID 137478985) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is [7-methoxy-9-(pyridin-3-ylmethylamino)-6-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[b]quinolin-1-yl] formate.
| Compound Name | [7-methoxy-9-(pyridin-3-ylmethylamino)-6-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[b]quinolin-1-yl] formate |
|---|---|
| PubChem CID | 137478985 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | [7-methoxy-9-(pyridin-3-ylmethylamino)-6-(3-pyrrolidin-1-ylpropoxy)-2,3-dihydro-1H-cyclopenta[b]quinolin-1-yl] formate |
| SMILES | COc1cc2c(NCc3cccnc3)c3c(nc2cc1OCCCN1CCCC1)CCC3OC=O |
| InChI | InChI=1S/C27H32N4O4/c1-33-24-14-20-22(15-25(24)34-13-5-12-31-10-2-3-11-31)30-21-7-8-23(35-18-32)26(21)27(20)29-17-19-6-4-9-28-16-19/h4,6,9,14-16,18,23H,2-3,5,7-8,10-13,17H2,1H3,(H,29,30) |
| InChIKey | NNTYMOIGSQHXNK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|