C23H28ClFN7O7P — CID 137482358
ethyl (2R)-2-[[[(1R,3R,4R,5R)-3-[2-amino-6-(methylamino)purin-9-yl]-1-(chloromethyl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate (PubChem CID 137482358) has the molecular formula C23H28ClFN7O7P and a molecular weight of 599.94 g/mol. Its IUPAC name is ethyl (2R)-2-[[[(1R,3R,4R,5R)-3-[2-amino-6-(methylamino)purin-9-yl]-1-(chloromethyl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate.
| Compound Name | ethyl (2R)-2-[[[(1R,3R,4R,5R)-3-[2-amino-6-(methylamino)purin-9-yl]-1-(chloromethyl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate |
|---|---|
| PubChem CID | 137482358 |
| Molecular Formula | C23H28ClFN7O7P |
| Molecular Weight | 599.94 g/mol |
| Exact Mass | 599.15 |
| IUPAC Name | ethyl (2R)-2-[[[(1R,3R,4R,5R)-3-[2-amino-6-(methylamino)purin-9-yl]-1-(chloromethyl)-4-fluoro-5-hydroxy-2-oxabicyclo[3.1.0]hexan-6-yl]oxy-phenoxyphosphoryl]amino]propanoate |
| SMILES | CCOC(=O)[C@@H](C)NP(=O)(Oc1ccccc1)OC1[C@@]2(CCl)O[C@@H](n3cnc4c(NC)nc(N)nc43)[C@H](F)[C@@]12O |
| InChI | InChI=1S/C23H28ClFN7O7P/c1-4-36-19(33)12(2)31-40(35,38-13-8-6-5-7-9-13)39-20-22(10-24)23(20,34)15(25)18(37-22)32-11-28-14-16(27-3)29-21(26)30-17(14)32/h5-9,11-12,15,18,20,34H,4,10H2,1-3H3,(H,31,35)(H3,26,27,29,30)/t12-,15+,18-,20?,22-,23-,40?/m1/s1 |
| InChIKey | WLOZVLVTAMHNAB-PIBNSFSASA-N |
| XLogP | 2.15 |
| TPSA | 184.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.94 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|