C21H27N — CID 137482907
3-[3-[(Z)-4-(3,4-dimethylphenyl)but-3-enyl]phenyl]propan-1-amine (PubChem CID 137482907) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 3-[3-[(Z)-4-(3,4-dimethylphenyl)but-3-enyl]phenyl]propan-1-amine.
| Compound Name | 3-[3-[(Z)-4-(3,4-dimethylphenyl)but-3-enyl]phenyl]propan-1-amine |
|---|---|
| PubChem CID | 137482907 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 3-[3-[(Z)-4-(3,4-dimethylphenyl)but-3-enyl]phenyl]propan-1-amine |
| SMILES | Cc1ccc(/C=C\CCc2cccc(CCCN)c2)cc1C |
| InChI | InChI=1S/C21H27N/c1-17-12-13-21(15-18(17)2)8-4-3-7-19-9-5-10-20(16-19)11-6-14-22/h4-5,8-10,12-13,15-16H,3,6-7,11,14,22H2,1-2H3/b8-4- |
| InChIKey | KJERTYLVLJCIQJ-YWEYNIOJSA-N |
| XLogP | 4.84 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |