About 3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine
3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine (PubChem CID 25100109) has the molecular formula C19H23N
and a molecular weight of 265.40 g/mol. Its IUPAC name is 3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine.
Molecular Properties
| Compound Name | 3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine |
| PubChem CID | 25100109 |
| Molecular Formula | C19H23N |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine |
| SMILES | Cc1ccc(C)c(/C=C\c2cccc(CCCN)c2)c1 |
| InChI | InChI=1S/C19H23N/c1-15-8-9-16(2)19(13-15)11-10-18-6-3-5-17(14-18)7-4-12-20/h3,5-6,8-11,13-14H,4,7,12,20H2,1-2H3/b11-10- |
| InChIKey | HNPWYERMGSZQFN-KHPPLWFESA-N |
| XLogP | 4.37 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine?
The IUPAC name of 3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine (CID 25100109) is 3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine.
What is the SMILES notation for 3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine?
The canonical SMILES for 3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine is Cc1ccc(C)c(/C=C\c2cccc(CCCN)c2)c1.
What is the InChIKey of 3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine?
The InChIKey is HNPWYERMGSZQFN-KHPPLWFESA-N. The full InChI is InChI=1S/C19H23N/c1-15-8-9-16(2)19(13-15)11-10-18-6-3-5-17(14-18)7-4-12-20/h3,5-6,8-11,13-14H,4,7,12,20H2,1-2H3/b11-10-.
What are the key properties of 3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine?
3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine has a molecular weight of 265.40 g/mol, XLogP of 4.37, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(Z)-2-(2,5-dimethylphenyl)ethenyl]phenyl]propan-1-amine is sourced from PubChem (CID 25100109), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).