C23H22O4 — CID 118579781
2-[3-[(Z)-2-(2-methyl-5-prop-2-enoyloxyphenyl)ethenyl]phenyl]ethyl prop-2-enoate (PubChem CID 118579781) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 2-[3-[(Z)-2-(2-methyl-5-prop-2-enoyloxyphenyl)ethenyl]phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[3-[(Z)-2-(2-methyl-5-prop-2-enoyloxyphenyl)ethenyl]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 118579781 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-[3-[(Z)-2-(2-methyl-5-prop-2-enoyloxyphenyl)ethenyl]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1cccc(/C=C\c2cc(OC(=O)C=C)ccc2C)c1 |
| InChI | InChI=1S/C23H22O4/c1-4-22(24)26-14-13-19-8-6-7-18(15-19)10-11-20-16-21(12-9-17(20)3)27-23(25)5-2/h4-12,15-16H,1-2,13-14H2,3H3/b11-10- |
| InChIKey | DOXPPMCTNOWHRF-KHPPLWFESA-N |
| XLogP | 4.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|