C27H26O4 — CID 129059868
2-[4-[3-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]phenyl]phenyl]ethyl prop-2-enoate (PubChem CID 129059868) has the molecular formula C27H26O4 and a molecular weight of 414.50 g/mol. Its IUPAC name is 2-[4-[3-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]phenyl]phenyl]ethyl prop-2-enoate.
| Compound Name | 2-[4-[3-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]phenyl]phenyl]ethyl prop-2-enoate |
|---|---|
| PubChem CID | 129059868 |
| Molecular Formula | C27H26O4 |
| Molecular Weight | 414.50 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-[4-[3-[4-(1-hydroxy-2-methylprop-2-enoxy)phenyl]phenyl]phenyl]ethyl prop-2-enoate |
| SMILES | C=CC(=O)OCCc1ccc(-c2cccc(-c3ccc(OC(O)C(=C)C)cc3)c2)cc1 |
| InChI | InChI=1S/C27H26O4/c1-4-26(28)30-17-16-20-8-10-21(11-9-20)23-6-5-7-24(18-23)22-12-14-25(15-13-22)31-27(29)19(2)3/h4-15,18,27,29H,1-2,16-17H2,3H3 |
| InChIKey | LWMXDZXYHSEYBQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.50 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|